3'-Nitro-α-piperidinopropiophenone
| 3-NPIPPP | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 262.30 g/mol [1] |
| Predicted LogP | 2.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C14H18N2O3 [1] |
| IUPAC name | 1-(3-nitrophenyl)-2-piperidin-1-ylpropan-1-one [1] |
| SMILES | CC(C(=O)C1=CC(=CC=C1)[N+](=O)[O-])N2CCCCC2 [1] |
| InChI | InChI=1S/C14H18N2O3/c1-11(15-8-3-2-4-9-15)14(17)12-6-5-7-13(10-12)16(18)19/h5-7,10-11H,2-4,8-9H2,1H3 [1] |
| InChIKey | LTLFRBMKBHQUTH-UHFFFAOYSA-N [1] |
3'-Nitro-α-piperidinopropiophenone (also known as 2-(N-Pyrrolidinyl)-3''-nitropropiophenone, Chembl599233, Schembl6055564 or Bdbm50308120) is a
Chemistry
Stereochemistry []
3'-Nitro-α-piperidinopropiophenone is a racemic mixture of the enantiomers.
| Stereoisomerism |
|---|
| Stereoisomer enumberation with rdkit |
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 45141809, 3'-Nitro-α-piperidinopropiophenone. Accessed August 23, 2026. https://pubchem.ncbi.nlm.nih.gov/compound/45141809