3,4-Dihydroxy-α-piperidinopropiophenone
| 3,4-DMPIPPP | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 249.30 g/mol [1] |
| Predicted LogP | 2.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C14H19NO3 [1] |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-2-piperidin-1-ylpropan-1-one [1] |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)O)O)N2CCCCC2 [1] |
| InChI | InChI=1S/C14H19NO3/c1-10(15-7-3-2-4-8-15)14(18)11-5-6-12(16)13(17)9-11/h5-6,9-10,16-17H,2-4,7-8H2,1H3 [1] |
| InChIKey | DIGTYXWSMJMTLM-UHFFFAOYSA-N [1] |
3,4-Dihydroxy-α-piperidinopropiophenone (also known as 1-(3,4-Dihydroxyphenyl)-2-piperidin-1-ylpropan-1-one or Schembl10042343) is a
Chemistry
Stereochemistry []
3,4-Dihydroxy-α-piperidinopropiophenone is a racemic mixture of the enantiomers.
| Stereoisomerism |
|---|
| Stereoisomer enumberation with rdkit |
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 214257, 3,4-Dihydroxy-α-piperidinopropiophenone. Accessed August 23, 2026. https://pubchem.ncbi.nlm.nih.gov/compound/214257