3-Methoxy-α-piperidinopropiophenone
| 3-MeO-PIPPP | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 247.33 g/mol [1] |
| Predicted LogP | 2.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H21NO2 [1] |
| IUPAC name | 1-(3-methoxyphenyl)-2-piperidin-1-ylpropan-1-one [1] |
| SMILES | CC(C(=O)C1=CC(=CC=C1)OC)N2CCCCC2 [1] |
| InChI | InChI=1S/C15H21NO2/c1-12(16-9-4-3-5-10-16)15(17)13-7-6-8-14(11-13)18-2/h6-8,11-12H,3-5,9-10H2,1-2H3 [1] |
| InChIKey | VIWKHXNVEIOPSC-UHFFFAOYSA-N [1] |
3-Methoxy-α-piperidinopropiophenone (also known as 2-(N-Pyrrolidinyl)-3''-methoxypropiophenone, Chembl580143 or Bdbm50308119) is a
Chemistry
Stereochemistry []
3-Methoxy-α-piperidinopropiophenone is a racemic mixture of the enantiomers.
| Stereoisomerism |
|---|
| Stereoisomer enumberation with rdkit |
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 45141808, 3-Methoxy-α-piperidinopropiophenone. Accessed August 23, 2026. https://pubchem.ncbi.nlm.nih.gov/compound/45141808